C25H28N2O4 — CID 42989954
N-[4-[(4-ethoxyphenyl)carbamoyl]phenyl]-9-oxobicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 42989954) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is N-[4-[(4-ethoxyphenyl)carbamoyl]phenyl]-9-oxobicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | N-[4-[(4-ethoxyphenyl)carbamoyl]phenyl]-9-oxobicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 42989954 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | N-[4-[(4-ethoxyphenyl)carbamoyl]phenyl]-9-oxobicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(NC(=O)C3CC4CCCC(C3)C4=O)cc2)cc1 |
| InChI | InChI=1S/C25H28N2O4/c1-2-31-22-12-10-21(11-13-22)26-24(29)16-6-8-20(9-7-16)27-25(30)19-14-17-4-3-5-18(15-19)23(17)28/h6-13,17-19H,2-5,14-15H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | NOZYLHLKQHCBDR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |