C14H18BrN7 — CID 42992321
2-N-[(E)-(2-bromophenyl)methylideneamino]-4-N,6-N-diethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 42992321) has the molecular formula C14H18BrN7 and a molecular weight of 364.25 g/mol. Its IUPAC name is 2-N-[(E)-(2-bromophenyl)methylideneamino]-4-N,6-N-diethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[(E)-(2-bromophenyl)methylideneamino]-4-N,6-N-diethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 42992321 |
| Molecular Formula | C14H18BrN7 |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 2-N-[(E)-(2-bromophenyl)methylideneamino]-4-N,6-N-diethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(NCC)nc(N/N=C/c2ccccc2Br)n1 |
| InChI | InChI=1S/C14H18BrN7/c1-3-16-12-19-13(17-4-2)21-14(20-12)22-18-9-10-7-5-6-8-11(10)15/h5-9H,3-4H2,1-2H3,(H3,16,17,19,20,21,22)/b18-9+ |
| InChIKey | VSNOZXUGTUAQNA-GIJQJNRQSA-N |
| XLogP | 2.94 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|