C17H26N2OS — CID 42992953
N-[2-(4-methoxyphenyl)ethyl]-3,5-dimethylpiperidine-1-carbothioamide (PubChem CID 42992953) has the molecular formula C17H26N2OS and a molecular weight of 306.47 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-3,5-dimethylpiperidine-1-carbothioamide.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-3,5-dimethylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 42992953 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-3,5-dimethylpiperidine-1-carbothioamide |
| SMILES | COc1ccc(CCNC(=S)N2CC(C)CC(C)C2)cc1 |
| InChI | InChI=1S/C17H26N2OS/c1-13-10-14(2)12-19(11-13)17(21)18-9-8-15-4-6-16(20-3)7-5-15/h4-7,13-14H,8-12H2,1-3H3,(H,18,21) |
| InChIKey | BPQQTEJIZMMVHS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|