C16H22ClN3O2 — CID 42994936
[1-(4-chlorophenyl)-3-(2-methylpiperidin-1-yl)-3-oxopropyl]urea (PubChem CID 42994936) has the molecular formula C16H22ClN3O2 and a molecular weight of 323.82 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-3-(2-methylpiperidin-1-yl)-3-oxopropyl]urea.
| Compound Name | [1-(4-chlorophenyl)-3-(2-methylpiperidin-1-yl)-3-oxopropyl]urea |
|---|---|
| PubChem CID | 42994936 |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | [1-(4-chlorophenyl)-3-(2-methylpiperidin-1-yl)-3-oxopropyl]urea |
| SMILES | CC1CCCCN1C(=O)CC(NC(N)=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H22ClN3O2/c1-11-4-2-3-9-20(11)15(21)10-14(19-16(18)22)12-5-7-13(17)8-6-12/h5-8,11,14H,2-4,9-10H2,1H3,(H3,18,19,22) |
| InChIKey | ZNELIVONOCIEFT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |