C17H28N2O2S — CID 4299563
1-(2,4-dimethoxyphenyl)-3-octylthiourea (PubChem CID 4299563) has the molecular formula C17H28N2O2S and a molecular weight of 324.49 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-octylthiourea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-octylthiourea |
|---|---|
| PubChem CID | 4299563 |
| Molecular Formula | C17H28N2O2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-octylthiourea |
| SMILES | CCCCCCCCNC(=S)Nc1ccc(OC)cc1OC |
| InChI | InChI=1S/C17H28N2O2S/c1-4-5-6-7-8-9-12-18-17(22)19-15-11-10-14(20-2)13-16(15)21-3/h10-11,13H,4-9,12H2,1-3H3,(H2,18,19,22) |
| InChIKey | CWQXVABUUXOJML-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|