C26H20N6O4 — CID 42995701
2-(2-cyanophenoxy)-N-[(E)-[3-[(E)-[[2-(2-cyanophenoxy)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide (PubChem CID 42995701) has the molecular formula C26H20N6O4 and a molecular weight of 480.48 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-[(E)-[3-[(E)-[[2-(2-cyanophenoxy)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2-cyanophenoxy)-N-[(E)-[3-[(E)-[[2-(2-cyanophenoxy)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 42995701 |
| Molecular Formula | C26H20N6O4 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-[(E)-[3-[(E)-[[2-(2-cyanophenoxy)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide |
| SMILES | N#Cc1ccccc1OCC(=O)N/N=C/c1cccc(/C=N/NC(=O)COc2ccccc2C#N)c1 |
| InChI | InChI=1S/C26H20N6O4/c27-13-21-8-1-3-10-23(21)35-17-25(33)31-29-15-19-6-5-7-20(12-19)16-30-32-26(34)18-36-24-11-4-2-9-22(24)14-28/h1-12,15-16H,17-18H2,(H,31,33)(H,32,34)/b29-15+,30-16+ |
| InChIKey | QQRSNGPDYIYGFS-CMNXJCJSSA-N |
| XLogP | 2.49 |
| TPSA | 148.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|