C25H21N3O4S2 — CID 42996951
4-methyl-7-[2-(morpholin-4-ylmethyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]oxychromen-2-one (PubChem CID 42996951) has the molecular formula C25H21N3O4S2 and a molecular weight of 491.59 g/mol. Its IUPAC name is 4-methyl-7-[2-(morpholin-4-ylmethyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]oxychromen-2-one.
| Compound Name | 4-methyl-7-[2-(morpholin-4-ylmethyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]oxychromen-2-one |
|---|---|
| PubChem CID | 42996951 |
| Molecular Formula | C25H21N3O4S2 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 4-methyl-7-[2-(morpholin-4-ylmethyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]oxychromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(Oc3nc(CN4CCOCC4)nc4scc(-c5cccs5)c34)ccc12 |
| InChI | InChI=1S/C25H21N3O4S2/c1-15-11-22(29)32-19-12-16(4-5-17(15)19)31-24-23-18(20-3-2-10-33-20)14-34-25(23)27-21(26-24)13-28-6-8-30-9-7-28/h2-5,10-12,14H,6-9,13H2,1H3 |
| InChIKey | YVZABUYXKJERBH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|