About 4-(8-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)benzonitrile;hydrochloride
4-(8-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)benzonitrile;hydrochloride (PubChem CID 42997555) has the molecular formula C18H13ClN2O2
and a molecular weight of 324.77 g/mol. Its IUPAC name is 4-(8-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)benzonitrile;hydrochloride.
Molecular Properties
| Compound Name | 4-(8-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)benzonitrile;hydrochloride |
| PubChem CID | 42997555 |
| Molecular Formula | C18H13ClN2O2 |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 4-(8-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)benzonitrile;hydrochloride |
| SMILES | Cc1cc(-c2ccc(C#N)cc2)nc2cc3c(cc12)OCO3.Cl |
| InChI | InChI=1S/C18H12N2O2.ClH/c1-11-6-15(13-4-2-12(9-19)3-5-13)20-16-8-18-17(7-14(11)16)21-10-22-18;/h2-8H,10H2,1H3;1H |
| InChIKey | RJBGWNILQFFCMB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(8-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)benzonitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(8-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)benzonitrile;hydrochloride?
The IUPAC name of 4-(8-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)benzonitrile;hydrochloride (CID 42997555) is 4-(8-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)benzonitrile;hydrochloride.
What is the SMILES notation for 4-(8-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)benzonitrile;hydrochloride?
The canonical SMILES for 4-(8-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)benzonitrile;hydrochloride is Cc1cc(-c2ccc(C#N)cc2)nc2cc3c(cc12)OCO3.Cl.
What is the InChIKey of 4-(8-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)benzonitrile;hydrochloride?
The InChIKey is RJBGWNILQFFCMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2O2.ClH/c1-11-6-15(13-4-2-12(9-19)3-5-13)20-16-8-18-17(7-14(11)16)21-10-22-18;/h2-8H,10H2,1H3;1H.
What are the key properties of 4-(8-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)benzonitrile;hydrochloride?
4-(8-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)benzonitrile;hydrochloride has a molecular weight of 324.77 g/mol, XLogP of 4.23, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(8-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)benzonitrile;hydrochloride is sourced from PubChem (CID 42997555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).