C15H22N4O4S — CID 42999196
2-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide (PubChem CID 42999196) has the molecular formula C15H22N4O4S and a molecular weight of 354.43 g/mol. Its IUPAC name is 2-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide.
| Compound Name | 2-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 42999196 |
| Molecular Formula | C15H22N4O4S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide |
| SMILES | Cc1cc(NC(=O)CSCC(=O)NCCCN2CCCC2=O)no1 |
| InChI | InChI=1S/C15H22N4O4S/c1-11-8-12(18-23-11)17-14(21)10-24-9-13(20)16-5-3-7-19-6-2-4-15(19)22/h8H,2-7,9-10H2,1H3,(H,16,20)(H,17,18,21) |
| InChIKey | ZWEXCSDMUCMZNK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|