C18H14F2N2O2S — CID 42999638
N-(5-benzyl-1,3-thiazol-2-yl)-2-(difluoromethoxy)benzamide (PubChem CID 42999638) has the molecular formula C18H14F2N2O2S and a molecular weight of 360.39 g/mol. Its IUPAC name is N-(5-benzyl-1,3-thiazol-2-yl)-2-(difluoromethoxy)benzamide.
| Compound Name | N-(5-benzyl-1,3-thiazol-2-yl)-2-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 42999638 |
| Molecular Formula | C18H14F2N2O2S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | N-(5-benzyl-1,3-thiazol-2-yl)-2-(difluoromethoxy)benzamide |
| SMILES | O=C(Nc1ncc(Cc2ccccc2)s1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C18H14F2N2O2S/c19-17(20)24-15-9-5-4-8-14(15)16(23)22-18-21-11-13(25-18)10-12-6-2-1-3-7-12/h1-9,11,17H,10H2,(H,21,22,23) |
| InChIKey | OJCVAUMFKIHRMG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |