C25H30N4O3S — CID 43003153
4-[[4-(2-methyl-5-piperidin-1-ylsulfonylbenzoyl)piperazin-1-yl]methyl]benzonitrile (PubChem CID 43003153) has the molecular formula C25H30N4O3S and a molecular weight of 466.61 g/mol. Its IUPAC name is 4-[[4-(2-methyl-5-piperidin-1-ylsulfonylbenzoyl)piperazin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-(2-methyl-5-piperidin-1-ylsulfonylbenzoyl)piperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 43003153 |
| Molecular Formula | C25H30N4O3S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 4-[[4-(2-methyl-5-piperidin-1-ylsulfonylbenzoyl)piperazin-1-yl]methyl]benzonitrile |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2)cc1C(=O)N1CCN(Cc2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C25H30N4O3S/c1-20-5-10-23(33(31,32)29-11-3-2-4-12-29)17-24(20)25(30)28-15-13-27(14-16-28)19-22-8-6-21(18-26)7-9-22/h5-10,17H,2-4,11-16,19H2,1H3 |
| InChIKey | CXJRDZMHANMBRO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |