C18H20FNO3 — CID 43003184
2-(4-fluorophenoxy)-N-[2-(2-methoxyphenyl)ethyl]propanamide (PubChem CID 43003184) has the molecular formula C18H20FNO3 and a molecular weight of 317.36 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-[2-(2-methoxyphenyl)ethyl]propanamide.
| Compound Name | 2-(4-fluorophenoxy)-N-[2-(2-methoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 43003184 |
| Molecular Formula | C18H20FNO3 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-[2-(2-methoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccccc1CCNC(=O)C(C)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C18H20FNO3/c1-13(23-16-9-7-15(19)8-10-16)18(21)20-12-11-14-5-3-4-6-17(14)22-2/h3-10,13H,11-12H2,1-2H3,(H,20,21) |
| InChIKey | OTPOLFFNJSIJCP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |