C22H27N3O2 — CID 43003309
N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-3-(1H-indol-3-yl)propanamide (PubChem CID 43003309) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-3-(1H-indol-3-yl)propanamide.
| Compound Name | N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-3-(1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 43003309 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-3-(1H-indol-3-yl)propanamide |
| SMILES | COc1ccc(C(CNC(=O)CCc2c[nH]c3ccccc23)N(C)C)cc1 |
| InChI | InChI=1S/C22H27N3O2/c1-25(2)21(16-8-11-18(27-3)12-9-16)15-24-22(26)13-10-17-14-23-20-7-5-4-6-19(17)20/h4-9,11-12,14,21,23H,10,13,15H2,1-3H3,(H,24,26) |
| InChIKey | LDZDUKCTJWVSMU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |