C12H12Cl2N2O3 — CID 43004765
2,2-dichloro-1-methyl-N-(2-methyl-3-nitrophenyl)cyclopropane-1-carboxamide (PubChem CID 43004765) has the molecular formula C12H12Cl2N2O3 and a molecular weight of 303.15 g/mol. Its IUPAC name is 2,2-dichloro-1-methyl-N-(2-methyl-3-nitrophenyl)cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-1-methyl-N-(2-methyl-3-nitrophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 43004765 |
| Molecular Formula | C12H12Cl2N2O3 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 2,2-dichloro-1-methyl-N-(2-methyl-3-nitrophenyl)cyclopropane-1-carboxamide |
| SMILES | Cc1c(NC(=O)C2(C)CC2(Cl)Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12Cl2N2O3/c1-7-8(4-3-5-9(7)16(18)19)15-10(17)11(2)6-12(11,13)14/h3-5H,6H2,1-2H3,(H,15,17) |
| InChIKey | KERDFMAXWODOOT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|