C21H23ClFN5O3 — CID 43004882
5-chloro-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-1-(4-fluorophenyl)-3-methylpyrazole-4-carboxamide (PubChem CID 43004882) has the molecular formula C21H23ClFN5O3 and a molecular weight of 447.90 g/mol. Its IUPAC name is 5-chloro-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-1-(4-fluorophenyl)-3-methylpyrazole-4-carboxamide.
| Compound Name | 5-chloro-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-1-(4-fluorophenyl)-3-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 43004882 |
| Molecular Formula | C21H23ClFN5O3 |
| Molecular Weight | 447.90 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 5-chloro-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-1-(4-fluorophenyl)-3-methylpyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(Cl)c1C(=O)NCCCN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C21H23ClFN5O3/c1-13-16(17(22)28(26-13)15-7-5-14(23)6-8-15)18(29)24-11-4-12-27-19(30)21(25-20(27)31)9-2-3-10-21/h5-8H,2-4,9-12H2,1H3,(H,24,29)(H,25,31) |
| InChIKey | CWGICQSOPOGTER-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.90 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|