About 1,3-bis(diethoxyphosphorylmethyl)-2,4-dihydroquinazoline
1,3-bis(diethoxyphosphorylmethyl)-2,4-dihydroquinazoline (PubChem CID 4300521) has the molecular formula C18H32N2O6P2
and a molecular weight of 434.41 g/mol. Its IUPAC name is 1,3-bis(diethoxyphosphorylmethyl)-2,4-dihydroquinazoline.
Molecular Properties
| Compound Name | 1,3-bis(diethoxyphosphorylmethyl)-2,4-dihydroquinazoline |
| PubChem CID | 4300521 |
| Molecular Formula | C18H32N2O6P2 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 1,3-bis(diethoxyphosphorylmethyl)-2,4-dihydroquinazoline |
| SMILES | CCOP(=O)(CN1Cc2ccccc2N(CP(=O)(OCC)OCC)C1)OCC |
| InChI | InChI=1S/C18H32N2O6P2/c1-5-23-27(21,24-6-2)15-19-13-17-11-9-10-12-18(17)20(14-19)16-28(22,25-7-3)26-8-4/h9-12H,5-8,13-16H2,1-4H3 |
| InChIKey | VCOIXUWZENYMHG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(diethoxyphosphorylmethyl)-2,4-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(diethoxyphosphorylmethyl)-2,4-dihydroquinazoline?
The IUPAC name of 1,3-bis(diethoxyphosphorylmethyl)-2,4-dihydroquinazoline (CID 4300521) is 1,3-bis(diethoxyphosphorylmethyl)-2,4-dihydroquinazoline.
What is the SMILES notation for 1,3-bis(diethoxyphosphorylmethyl)-2,4-dihydroquinazoline?
The canonical SMILES for 1,3-bis(diethoxyphosphorylmethyl)-2,4-dihydroquinazoline is CCOP(=O)(CN1Cc2ccccc2N(CP(=O)(OCC)OCC)C1)OCC.
What is the InChIKey of 1,3-bis(diethoxyphosphorylmethyl)-2,4-dihydroquinazoline?
The InChIKey is VCOIXUWZENYMHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N2O6P2/c1-5-23-27(21,24-6-2)15-19-13-17-11-9-10-12-18(17)20(14-19)16-28(22,25-7-3)26-8-4/h9-12H,5-8,13-16H2,1-4H3.
What are the key properties of 1,3-bis(diethoxyphosphorylmethyl)-2,4-dihydroquinazoline?
1,3-bis(diethoxyphosphorylmethyl)-2,4-dihydroquinazoline has a molecular weight of 434.41 g/mol, XLogP of 4.71, 12 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(diethoxyphosphorylmethyl)-2,4-dihydroquinazoline is sourced from PubChem (CID 4300521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).