C21H27N3O4 — CID 43006599
N-[2-[[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]amino]-2-oxoethyl]furan-2-carboxamide (PubChem CID 43006599) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[2-[[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]amino]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]amino]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 43006599 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N-[2-[[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]amino]-2-oxoethyl]furan-2-carboxamide |
| SMILES | COc1ccc(C(CNC(=O)CNC(=O)c2ccco2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H27N3O4/c1-27-17-9-7-16(8-10-17)18(24-11-3-2-4-12-24)14-22-20(25)15-23-21(26)19-6-5-13-28-19/h5-10,13,18H,2-4,11-12,14-15H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | KTCZBFXSXLLXDJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |