C24H31N3O4S — CID 43006606
N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-3-(prop-2-enylsulfamoyl)benzamide (PubChem CID 43006606) has the molecular formula C24H31N3O4S and a molecular weight of 457.60 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-3-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-3-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 43006606 |
| Molecular Formula | C24H31N3O4S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-3-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)NCC(c2ccc(OC)cc2)N2CCCCC2)c1 |
| InChI | InChI=1S/C24H31N3O4S/c1-3-14-26-32(29,30)22-9-7-8-20(17-22)24(28)25-18-23(27-15-5-4-6-16-27)19-10-12-21(31-2)13-11-19/h3,7-13,17,23,26H,1,4-6,14-16,18H2,2H3,(H,25,28) |
| InChIKey | VLEFLXDIMYJYGB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|