About 3-(1,3,4-oxadiazol-2-yl)phenol
3-(1,3,4-oxadiazol-2-yl)phenol (PubChem CID 4300762) has the molecular formula C8H6N2O2
and a molecular weight of 162.15 g/mol. Its IUPAC name is 3-(1,3,4-oxadiazol-2-yl)phenol.
Molecular Properties
| Compound Name | 3-(1,3,4-oxadiazol-2-yl)phenol |
| PubChem CID | 4300762 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 3-(1,3,4-oxadiazol-2-yl)phenol |
| SMILES | Oc1cccc(-c2nnco2)c1 |
| InChI | InChI=1S/C8H6N2O2/c11-7-3-1-2-6(4-7)8-10-9-5-12-8/h1-5,11H |
| InChIKey | CSMNFUDFDBVTHP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,3,4-oxadiazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3,4-oxadiazol-2-yl)phenol?
The IUPAC name of 3-(1,3,4-oxadiazol-2-yl)phenol (CID 4300762) is 3-(1,3,4-oxadiazol-2-yl)phenol.
What is the SMILES notation for 3-(1,3,4-oxadiazol-2-yl)phenol?
The canonical SMILES for 3-(1,3,4-oxadiazol-2-yl)phenol is Oc1cccc(-c2nnco2)c1.
What is the InChIKey of 3-(1,3,4-oxadiazol-2-yl)phenol?
The InChIKey is CSMNFUDFDBVTHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2/c11-7-3-1-2-6(4-7)8-10-9-5-12-8/h1-5,11H.
What are the key properties of 3-(1,3,4-oxadiazol-2-yl)phenol?
3-(1,3,4-oxadiazol-2-yl)phenol has a molecular weight of 162.15 g/mol, XLogP of 1.44, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3,4-oxadiazol-2-yl)phenol is sourced from PubChem (CID 4300762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).