C18H14F5N3O3 — CID 43008433
(2,6-difluorophenyl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 43008433) has the molecular formula C18H14F5N3O3 and a molecular weight of 415.32 g/mol. Its IUPAC name is (2,6-difluorophenyl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | (2,6-difluorophenyl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 43008433 |
| Molecular Formula | C18H14F5N3O3 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | (2,6-difluorophenyl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1c(F)cccc1F)N1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H14F5N3O3/c19-12-2-1-3-13(20)16(12)17(27)25-8-6-24(7-9-25)14-5-4-11(18(21,22)23)10-15(14)26(28)29/h1-5,10H,6-9H2 |
| InChIKey | RVIFKLGGKCNJMY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|