C11H9F3N2O3 — CID 43008648
(E)-3-(3-nitrophenyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide (PubChem CID 43008648) has the molecular formula C11H9F3N2O3 and a molecular weight of 274.20 g/mol. Its IUPAC name is (E)-3-(3-nitrophenyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide.
| Compound Name | (E)-3-(3-nitrophenyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
|---|---|
| PubChem CID | 43008648 |
| Molecular Formula | C11H9F3N2O3 |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | (E)-3-(3-nitrophenyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)NCC(F)(F)F |
| InChI | InChI=1S/C11H9F3N2O3/c12-11(13,14)7-15-10(17)5-4-8-2-1-3-9(6-8)16(18)19/h1-6H,7H2,(H,15,17)/b5-4+ |
| InChIKey | AFCCWZNMAMZXKT-SNAWJCMRSA-N |
| XLogP | 2.29 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|