About N,N-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]acetamide
N,N-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]acetamide (PubChem CID 4301137) has the molecular formula C32H49NO3
and a molecular weight of 495.75 g/mol. Its IUPAC name is N,N-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]acetamide.
Molecular Properties
| Compound Name | N,N-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]acetamide |
| PubChem CID | 4301137 |
| Molecular Formula | C32H49NO3 |
| Molecular Weight | 495.75 g/mol |
| Exact Mass | 495.37 |
| IUPAC Name | N,N-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]acetamide |
| SMILES | CC(=O)N(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C32H49NO3/c1-20(34)33(18-21-14-23(29(2,3)4)27(35)24(15-21)30(5,6)7)19-22-16-25(31(8,9)10)28(36)26(17-22)32(11,12)13/h14-17,35-36H,18-19H2,1-13H3 |
| InChIKey | VRWFVUUNMMHXQU-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.75 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]acetamide?
The IUPAC name of N,N-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]acetamide (CID 4301137) is N,N-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]acetamide.
What is the SMILES notation for N,N-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]acetamide?
The canonical SMILES for N,N-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]acetamide is CC(=O)N(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.
What is the InChIKey of N,N-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]acetamide?
The InChIKey is VRWFVUUNMMHXQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H49NO3/c1-20(34)33(18-21-14-23(29(2,3)4)27(35)24(15-21)30(5,6)7)19-22-16-25(31(8,9)10)28(36)26(17-22)32(11,12)13/h14-17,35-36H,18-19H2,1-13H3.
What are the key properties of N,N-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]acetamide?
N,N-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]acetamide has a molecular weight of 495.75 g/mol, XLogP of 7.84, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]acetamide is sourced from PubChem (CID 4301137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).