C24H21N3O5 — CID 43013414
2-[4-(1,3-benzodioxol-5-ylmethyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-naphthalen-2-ylacetamide (PubChem CID 43013414) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-ylmethyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 43013414 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-naphthalen-2-ylacetamide |
| SMILES | CC1(Cc2ccc3c(c2)OCO3)NC(=O)N(CC(=O)Nc2ccc3ccccc3c2)C1=O |
| InChI | InChI=1S/C24H21N3O5/c1-24(12-15-6-9-19-20(10-15)32-14-31-19)22(29)27(23(30)26-24)13-21(28)25-18-8-7-16-4-2-3-5-17(16)11-18/h2-11H,12-14H2,1H3,(H,25,28)(H,26,30) |
| InChIKey | PTQMADIMXDWHNS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|