C14H15Cl2N3O — CID 43015950
N-(1-cyano-1-cyclopropylethyl)-2-(2,5-dichloroanilino)acetamide (PubChem CID 43015950) has the molecular formula C14H15Cl2N3O and a molecular weight of 312.20 g/mol. Its IUPAC name is N-(1-cyano-1-cyclopropylethyl)-2-(2,5-dichloroanilino)acetamide.
| Compound Name | N-(1-cyano-1-cyclopropylethyl)-2-(2,5-dichloroanilino)acetamide |
|---|---|
| PubChem CID | 43015950 |
| Molecular Formula | C14H15Cl2N3O |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | N-(1-cyano-1-cyclopropylethyl)-2-(2,5-dichloroanilino)acetamide |
| SMILES | CC(C#N)(NC(=O)CNc1cc(Cl)ccc1Cl)C1CC1 |
| InChI | InChI=1S/C14H15Cl2N3O/c1-14(8-17,9-2-3-9)19-13(20)7-18-12-6-10(15)4-5-11(12)16/h4-6,9,18H,2-3,7H2,1H3,(H,19,20) |
| InChIKey | FGJGJCGAWDEZRC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |