C19H23N3O2S — CID 43015996
2-(2-ethylanilino)-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone (PubChem CID 43015996) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is 2-(2-ethylanilino)-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(2-ethylanilino)-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 43015996 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 2-(2-ethylanilino)-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone |
| SMILES | CCc1ccccc1NCC(=O)N1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C19H23N3O2S/c1-2-15-6-3-4-7-16(15)20-14-18(23)21-9-11-22(12-10-21)19(24)17-8-5-13-25-17/h3-8,13,20H,2,9-12,14H2,1H3 |
| InChIKey | ROARUIPFZRFDCZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |