C23H18N4O7 — CID 43016285
[2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 1-amino-9,10-dioxoanthracene-2-carboxylate (PubChem CID 43016285) has the molecular formula C23H18N4O7 and a molecular weight of 462.42 g/mol. Its IUPAC name is [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 1-amino-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 1-amino-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 43016285 |
| Molecular Formula | C23H18N4O7 |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 1-amino-9,10-dioxoanthracene-2-carboxylate |
| SMILES | Cn1c(N)c(C(=O)COC(=O)c2ccc3c(c2N)C(=O)c2ccccc2C3=O)c(=O)n(C)c1=O |
| InChI | InChI=1S/C23H18N4O7/c1-26-20(25)16(21(31)27(2)23(26)33)14(28)9-34-22(32)13-8-7-12-15(17(13)24)19(30)11-6-4-3-5-10(11)18(12)29/h3-8H,9,24-25H2,1-2H3 |
| InChIKey | ZYTDDOFYQSKEHS-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 173.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|