C19H20N4O3 — CID 43016717
2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(3-methyl-2-pyridinyl)acetamide (PubChem CID 43016717) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(3-methyl-2-pyridinyl)acetamide.
| Compound Name | 2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(3-methyl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 43016717 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(3-methyl-2-pyridinyl)acetamide |
| SMILES | Cc1ccc(C2(C)NC(=O)N(CC(=O)Nc3ncccc3C)C2=O)cc1 |
| InChI | InChI=1S/C19H20N4O3/c1-12-6-8-14(9-7-12)19(3)17(25)23(18(26)22-19)11-15(24)21-16-13(2)5-4-10-20-16/h4-10H,11H2,1-3H3,(H,22,26)(H,20,21,24) |
| InChIKey | NXYJXGOIAPSGEB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|