C25H32N2O5 — CID 43021963
1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxo-N-(3-phenylmethoxypropyl)pyrrolidine-3-carboxamide (PubChem CID 43021963) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxo-N-(3-phenylmethoxypropyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxo-N-(3-phenylmethoxypropyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 43021963 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxo-N-(3-phenylmethoxypropyl)pyrrolidine-3-carboxamide |
| SMILES | COc1ccc(CCN2CC(C(=O)NCCCOCc3ccccc3)CC2=O)cc1OC |
| InChI | InChI=1S/C25H32N2O5/c1-30-22-10-9-19(15-23(22)31-2)11-13-27-17-21(16-24(27)28)25(29)26-12-6-14-32-18-20-7-4-3-5-8-20/h3-5,7-10,15,21H,6,11-14,16-18H2,1-2H3,(H,26,29) |
| InChIKey | SYDHCHHZDBQLLN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|