C9H13F3N4O — CID 43022521
N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hexanamide (PubChem CID 43022521) has the molecular formula C9H13F3N4O and a molecular weight of 250.22 g/mol. Its IUPAC name is N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hexanamide.
| Compound Name | N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hexanamide |
|---|---|
| PubChem CID | 43022521 |
| Molecular Formula | C9H13F3N4O |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hexanamide |
| SMILES | CCCCCC(=O)Nc1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H13F3N4O/c1-2-3-4-5-6(17)13-8-14-7(15-16-8)9(10,11)12/h2-5H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | SIBNZAJNSCRUGB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|