C17H16ClN5O3S2 — CID 43023545
N-[4-[2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylpropanoyl]phenyl]methanesulfonamide (PubChem CID 43023545) has the molecular formula C17H16ClN5O3S2 and a molecular weight of 437.93 g/mol. Its IUPAC name is N-[4-[2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylpropanoyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylpropanoyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 43023545 |
| Molecular Formula | C17H16ClN5O3S2 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | N-[4-[2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylpropanoyl]phenyl]methanesulfonamide |
| SMILES | CC(Sc1nnnn1-c1ccc(Cl)cc1)C(=O)c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H16ClN5O3S2/c1-11(16(24)12-3-7-14(8-4-12)20-28(2,25)26)27-17-19-21-22-23(17)15-9-5-13(18)6-10-15/h3-11,20H,1-2H3 |
| InChIKey | MJGHCPRHUYBOJU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |