C21H25N3O7S2 — CID 43024520
N-(2-ethoxy-5-morpholin-4-ylsulfonylphenyl)-2-(4-nitrophenyl)sulfanylpropanamide (PubChem CID 43024520) has the molecular formula C21H25N3O7S2 and a molecular weight of 495.58 g/mol. Its IUPAC name is N-(2-ethoxy-5-morpholin-4-ylsulfonylphenyl)-2-(4-nitrophenyl)sulfanylpropanamide.
| Compound Name | N-(2-ethoxy-5-morpholin-4-ylsulfonylphenyl)-2-(4-nitrophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 43024520 |
| Molecular Formula | C21H25N3O7S2 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | N-(2-ethoxy-5-morpholin-4-ylsulfonylphenyl)-2-(4-nitrophenyl)sulfanylpropanamide |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)C(C)Sc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H25N3O7S2/c1-3-31-20-9-8-18(33(28,29)23-10-12-30-13-11-23)14-19(20)22-21(25)15(2)32-17-6-4-16(5-7-17)24(26)27/h4-9,14-15H,3,10-13H2,1-2H3,(H,22,25) |
| InChIKey | KFWXHRXSCQGCHE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|