C23H20N6O2S2 — CID 43025956
N-(2,3-dimethylphenyl)-5-[[5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-amine (PubChem CID 43025956) has the molecular formula C23H20N6O2S2 and a molecular weight of 476.59 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-5-[[5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(2,3-dimethylphenyl)-5-[[5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 43025956 |
| Molecular Formula | C23H20N6O2S2 |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | N-(2,3-dimethylphenyl)-5-[[5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1cccc(Nc2nnc(SCc3nnc(-c4c(-c5ccccc5)noc4C)o3)s2)c1C |
| InChI | InChI=1S/C23H20N6O2S2/c1-13-8-7-11-17(14(13)2)24-22-27-28-23(33-22)32-12-18-25-26-21(30-18)19-15(3)31-29-20(19)16-9-5-4-6-10-16/h4-11H,12H2,1-3H3,(H,24,27) |
| InChIKey | XINAYEKSXPVPKA-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |