C22H28N6O3S2 — CID 43027916
N-[5-[1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-methylpentanamide (PubChem CID 43027916) has the molecular formula C22H28N6O3S2 and a molecular weight of 488.64 g/mol. Its IUPAC name is N-[5-[1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-methylpentanamide.
| Compound Name | N-[5-[1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 43027916 |
| Molecular Formula | C22H28N6O3S2 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | N-[5-[1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-methylpentanamide |
| SMILES | Cc1c(NC(=O)C(C)Sc2nnc(NC(=O)CCC(C)C)s2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C22H28N6O3S2/c1-13(2)11-12-17(29)23-21-25-26-22(33-21)32-15(4)19(30)24-18-14(3)27(5)28(20(18)31)16-9-7-6-8-10-16/h6-10,13,15H,11-12H2,1-5H3,(H,24,30)(H,23,25,29) |
| InChIKey | SWMZVHDQDVFNIL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|