C15H18N4OS — CID 43028754
2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-methyl-N-phenylpropanamide (PubChem CID 43028754) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-methyl-N-phenylpropanamide.
| Compound Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-methyl-N-phenylpropanamide |
|---|---|
| PubChem CID | 43028754 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-methyl-N-phenylpropanamide |
| SMILES | Cc1cc(N)nc(SC(C)C(=O)N(C)c2ccccc2)n1 |
| InChI | InChI=1S/C15H18N4OS/c1-10-9-13(16)18-15(17-10)21-11(2)14(20)19(3)12-7-5-4-6-8-12/h4-9,11H,1-3H3,(H2,16,17,18) |
| InChIKey | NXGOIGBDKKBIMC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |