C20H15F3N4O4 — CID 43028938
[1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] quinoxaline-2-carboxylate (PubChem CID 43028938) has the molecular formula C20H15F3N4O4 and a molecular weight of 432.36 g/mol. Its IUPAC name is [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] quinoxaline-2-carboxylate.
| Compound Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 43028938 |
| Molecular Formula | C20H15F3N4O4 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] quinoxaline-2-carboxylate |
| SMILES | CC(OC(=O)c1cnc2ccccc2n1)C(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H15F3N4O4/c1-10(31-20(30)15-8-24-12-4-2-3-5-13(12)26-15)19(29)25-9-16(28)27-14-7-6-11(21)17(22)18(14)23/h2-8,10H,9H2,1H3,(H,25,29)(H,27,28) |
| InChIKey | UQMSCUVIMMIQIH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|