About 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidine
3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidine (PubChem CID 4302965) has the molecular formula C20H19F6NO
and a molecular weight of 403.37 g/mol. Its IUPAC name is 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidine.
Molecular Properties
| Compound Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidine |
| PubChem CID | 4302965 |
| Molecular Formula | C20H19F6NO |
| Molecular Weight | 403.37 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidine |
| SMILES | FC(F)(F)c1cc(COC2CCCNC2c2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F6NO/c21-19(22,23)15-9-13(10-16(11-15)20(24,25)26)12-28-17-7-4-8-27-18(17)14-5-2-1-3-6-14/h1-3,5-6,9-11,17-18,27H,4,7-8,12H2 |
| InChIKey | FCDRFVCGMLUYPG-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.37 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidine?
The IUPAC name of 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidine (CID 4302965) is 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidine.
What is the SMILES notation for 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidine?
The canonical SMILES for 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidine is FC(F)(F)c1cc(COC2CCCNC2c2ccccc2)cc(C(F)(F)F)c1.
What is the InChIKey of 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidine?
The InChIKey is FCDRFVCGMLUYPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19F6NO/c21-19(22,23)15-9-13(10-16(11-15)20(24,25)26)12-28-17-7-4-8-27-18(17)14-5-2-1-3-6-14/h1-3,5-6,9-11,17-18,27H,4,7-8,12H2.
What are the key properties of 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidine?
3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidine has a molecular weight of 403.37 g/mol, XLogP of 5.73, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidine is sourced from PubChem (CID 4302965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).