C36H18O8 — CID 4303036
8-[2-[2-[(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)oxy]phenyl]phenoxy]-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (PubChem CID 4303036) has the molecular formula C36H18O8 and a molecular weight of 578.53 g/mol. Its IUPAC name is 8-[2-[2-[(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)oxy]phenyl]phenoxy]-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione.
| Compound Name | 8-[2-[2-[(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)oxy]phenyl]phenoxy]-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
|---|---|
| PubChem CID | 4303036 |
| Molecular Formula | C36H18O8 |
| Molecular Weight | 578.53 g/mol |
| Exact Mass | 578.10 |
| IUPAC Name | 8-[2-[2-[(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)oxy]phenyl]phenoxy]-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| SMILES | O=C1OC(=O)c2ccc(Oc3ccccc3-c3ccccc3Oc3ccc4c5c(cccc35)C(=O)OC4=O)c3cccc1c23 |
| InChI | InChI=1S/C36H18O8/c37-33-23-11-5-9-21-29(17-15-25(31(21)23)35(39)43-33)41-27-13-3-1-7-19(27)20-8-2-4-14-28(20)42-30-18-16-26-32-22(30)10-6-12-24(32)34(38)44-36(26)40/h1-18H |
| InChIKey | OTXBJILILXBZDZ-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.53 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|