C21H23N3O5S2 — CID 43031119
6-methyl-5-(2-methylbutyl)-2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 43031119) has the molecular formula C21H23N3O5S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 6-methyl-5-(2-methylbutyl)-2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 6-methyl-5-(2-methylbutyl)-2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 43031119 |
| Molecular Formula | C21H23N3O5S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 6-methyl-5-(2-methylbutyl)-2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCC(C)Cc1c(C)sc2nc(SCc3cc([N+](=O)[O-])cc4c3OCOC4)[nH]c(=O)c12 |
| InChI | InChI=1S/C21H23N3O5S2/c1-4-11(2)5-16-12(3)31-20-17(16)19(25)22-21(23-20)30-9-14-7-15(24(26)27)6-13-8-28-10-29-18(13)14/h6-7,11H,4-5,8-10H2,1-3H3,(H,22,23,25) |
| InChIKey | ONYXHVVPKLNRAV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|