C18H16N4OS2 — CID 43031924
2-[1-(1-prop-2-enylbenzimidazol-2-yl)sulfanylethyl]-5-thiophen-2-yl-1,3,4-oxadiazole (PubChem CID 43031924) has the molecular formula C18H16N4OS2 and a molecular weight of 368.49 g/mol. Its IUPAC name is 2-[1-(1-prop-2-enylbenzimidazol-2-yl)sulfanylethyl]-5-thiophen-2-yl-1,3,4-oxadiazole.
| Compound Name | 2-[1-(1-prop-2-enylbenzimidazol-2-yl)sulfanylethyl]-5-thiophen-2-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 43031924 |
| Molecular Formula | C18H16N4OS2 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 2-[1-(1-prop-2-enylbenzimidazol-2-yl)sulfanylethyl]-5-thiophen-2-yl-1,3,4-oxadiazole |
| SMILES | C=CCn1c(SC(C)c2nnc(-c3cccs3)o2)nc2ccccc21 |
| InChI | InChI=1S/C18H16N4OS2/c1-3-10-22-14-8-5-4-7-13(14)19-18(22)25-12(2)16-20-21-17(23-16)15-9-6-11-24-15/h3-9,11-12H,1,10H2,2H3 |
| InChIKey | OAMFCZWOZYZTCC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|