About 2-methoxybenzene-1,3,5-triol
2-methoxybenzene-1,3,5-triol (PubChem CID 4303263) has the molecular formula C7H8O4
and a molecular weight of 156.14 g/mol. Its IUPAC name is 2-methoxybenzene-1,3,5-triol.
Molecular Properties
| Compound Name | 2-methoxybenzene-1,3,5-triol |
| PubChem CID | 4303263 |
| Molecular Formula | C7H8O4 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 2-methoxybenzene-1,3,5-triol |
| SMILES | COc1c(O)cc(O)cc1O |
| InChI | InChI=1S/C7H8O4/c1-11-7-5(9)2-4(8)3-6(7)10/h2-3,8-10H,1H3 |
| InChIKey | ASTPOGDWGNJVEW-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxybenzene-1,3,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxybenzene-1,3,5-triol?
The IUPAC name of 2-methoxybenzene-1,3,5-triol (CID 4303263) is 2-methoxybenzene-1,3,5-triol.
What is the SMILES notation for 2-methoxybenzene-1,3,5-triol?
The canonical SMILES for 2-methoxybenzene-1,3,5-triol is COc1c(O)cc(O)cc1O.
What is the InChIKey of 2-methoxybenzene-1,3,5-triol?
The InChIKey is ASTPOGDWGNJVEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4/c1-11-7-5(9)2-4(8)3-6(7)10/h2-3,8-10H,1H3.
What are the key properties of 2-methoxybenzene-1,3,5-triol?
2-methoxybenzene-1,3,5-triol has a molecular weight of 156.14 g/mol, XLogP of 0.81, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxybenzene-1,3,5-triol is sourced from PubChem (CID 4303263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).