C24H24N4O2S2 — CID 43032702
2-[4-[(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)methyl]-1,3-thiazol-2-yl]-N-(4-methylphenyl)acetamide (PubChem CID 43032702) has the molecular formula C24H24N4O2S2 and a molecular weight of 464.62 g/mol. Its IUPAC name is 2-[4-[(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)methyl]-1,3-thiazol-2-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-[(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)methyl]-1,3-thiazol-2-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 43032702 |
| Molecular Formula | C24H24N4O2S2 |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 2-[4-[(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)methyl]-1,3-thiazol-2-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cc2nc(Cn3cnc4sc5c(c4c3=O)CCC(C)C5)cs2)cc1 |
| InChI | InChI=1S/C24H24N4O2S2/c1-14-3-6-16(7-4-14)26-20(29)10-21-27-17(12-31-21)11-28-13-25-23-22(24(28)30)18-8-5-15(2)9-19(18)32-23/h3-4,6-7,12-13,15H,5,8-11H2,1-2H3,(H,26,29) |
| InChIKey | DIKFMMPHRMJCMO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |