C25H26N2O6 — CID 43033084
[2-[1-(furan-2-yl)ethylamino]-2-oxoethyl] 2-[3-(4-methoxyphenyl)propanoylamino]benzoate (PubChem CID 43033084) has the molecular formula C25H26N2O6 and a molecular weight of 450.49 g/mol. Its IUPAC name is [2-[1-(furan-2-yl)ethylamino]-2-oxoethyl] 2-[3-(4-methoxyphenyl)propanoylamino]benzoate.
| Compound Name | [2-[1-(furan-2-yl)ethylamino]-2-oxoethyl] 2-[3-(4-methoxyphenyl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 43033084 |
| Molecular Formula | C25H26N2O6 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | [2-[1-(furan-2-yl)ethylamino]-2-oxoethyl] 2-[3-(4-methoxyphenyl)propanoylamino]benzoate |
| SMILES | COc1ccc(CCC(=O)Nc2ccccc2C(=O)OCC(=O)NC(C)c2ccco2)cc1 |
| InChI | InChI=1S/C25H26N2O6/c1-17(22-8-5-15-32-22)26-24(29)16-33-25(30)20-6-3-4-7-21(20)27-23(28)14-11-18-9-12-19(31-2)13-10-18/h3-10,12-13,15,17H,11,14,16H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | XFMJBGQHBKQDJW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |