C19H20FNO3 — CID 43033960
[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-(3-fluorophenyl)methanone (PubChem CID 43033960) has the molecular formula C19H20FNO3 and a molecular weight of 329.37 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-(3-fluorophenyl)methanone.
| Compound Name | [2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 43033960 |
| Molecular Formula | C19H20FNO3 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-(3-fluorophenyl)methanone |
| SMILES | COc1ccc(OC)c(C2CCCN2C(=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C19H20FNO3/c1-23-15-8-9-18(24-2)16(12-15)17-7-4-10-21(17)19(22)13-5-3-6-14(20)11-13/h3,5-6,8-9,11-12,17H,4,7,10H2,1-2H3 |
| InChIKey | MVSIWYYYNLCZJI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |