About ethyl 1-(2,4-dimethylphenyl)-2-methyl-5-(3-phenylprop-2-enoyloxy)indole-3-carboxylate
ethyl 1-(2,4-dimethylphenyl)-2-methyl-5-(3-phenylprop-2-enoyloxy)indole-3-carboxylate (PubChem CID 4303614) has the molecular formula C29H27NO4
and a molecular weight of 453.54 g/mol. Its IUPAC name is ethyl 1-(2,4-dimethylphenyl)-2-methyl-5-(3-phenylprop-2-enoyloxy)indole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(2,4-dimethylphenyl)-2-methyl-5-(3-phenylprop-2-enoyloxy)indole-3-carboxylate |
| PubChem CID | 4303614 |
| Molecular Formula | C29H27NO4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | ethyl 1-(2,4-dimethylphenyl)-2-methyl-5-(3-phenylprop-2-enoyloxy)indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(-c2ccc(C)cc2C)c2ccc(OC(=O)C=Cc3ccccc3)cc12 |
| InChI | InChI=1S/C29H27NO4/c1-5-33-29(32)28-21(4)30(25-14-11-19(2)17-20(25)3)26-15-13-23(18-24(26)28)34-27(31)16-12-22-9-7-6-8-10-22/h6-18H,5H2,1-4H3 |
| InChIKey | QOBSQRJXMFNNGV-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-(2,4-dimethylphenyl)-2-methyl-5-(3-phenylprop-2-enoyloxy)indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(2,4-dimethylphenyl)-2-methyl-5-(3-phenylprop-2-enoyloxy)indole-3-carboxylate?
The IUPAC name of ethyl 1-(2,4-dimethylphenyl)-2-methyl-5-(3-phenylprop-2-enoyloxy)indole-3-carboxylate (CID 4303614) is ethyl 1-(2,4-dimethylphenyl)-2-methyl-5-(3-phenylprop-2-enoyloxy)indole-3-carboxylate.
What is the SMILES notation for ethyl 1-(2,4-dimethylphenyl)-2-methyl-5-(3-phenylprop-2-enoyloxy)indole-3-carboxylate?
The canonical SMILES for ethyl 1-(2,4-dimethylphenyl)-2-methyl-5-(3-phenylprop-2-enoyloxy)indole-3-carboxylate is CCOC(=O)c1c(C)n(-c2ccc(C)cc2C)c2ccc(OC(=O)C=Cc3ccccc3)cc12.
What is the InChIKey of ethyl 1-(2,4-dimethylphenyl)-2-methyl-5-(3-phenylprop-2-enoyloxy)indole-3-carboxylate?
The InChIKey is QOBSQRJXMFNNGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H27NO4/c1-5-33-29(32)28-21(4)30(25-14-11-19(2)17-20(25)3)26-15-13-23(18-24(26)28)34-27(31)16-12-22-9-7-6-8-10-22/h6-18H,5H2,1-4H3.
What are the key properties of ethyl 1-(2,4-dimethylphenyl)-2-methyl-5-(3-phenylprop-2-enoyloxy)indole-3-carboxylate?
ethyl 1-(2,4-dimethylphenyl)-2-methyl-5-(3-phenylprop-2-enoyloxy)indole-3-carboxylate has a molecular weight of 453.54 g/mol, XLogP of 6.35, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(2,4-dimethylphenyl)-2-methyl-5-(3-phenylprop-2-enoyloxy)indole-3-carboxylate is sourced from PubChem (CID 4303614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).