About bromo-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane
bromo-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane (PubChem CID 4303687) has the molecular formula C20H34BBr
and a molecular weight of 365.21 g/mol. Its IUPAC name is bromo-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane.
Molecular Properties
| Compound Name | bromo-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane |
| PubChem CID | 4303687 |
| Molecular Formula | C20H34BBr |
| Molecular Weight | 365.21 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | bromo-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane |
| SMILES | CC1C(B(Br)C2CC3CC(C2C)C3(C)C)CC2CC1C2(C)C |
| InChI | InChI=1S/C20H34BBr/c1-11-15-7-13(19(15,3)4)9-17(11)21(22)18-10-14-8-16(12(18)2)20(14,5)6/h11-18H,7-10H2,1-6H3 |
| InChIKey | FKBAVEASVZAXFW-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.21 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bromo-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane?
The IUPAC name of bromo-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane (CID 4303687) is bromo-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane.
What is the SMILES notation for bromo-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane?
The canonical SMILES for bromo-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane is CC1C(B(Br)C2CC3CC(C2C)C3(C)C)CC2CC1C2(C)C.
What is the InChIKey of bromo-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane?
The InChIKey is FKBAVEASVZAXFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34BBr/c1-11-15-7-13(19(15,3)4)9-17(11)21(22)18-10-14-8-16(12(18)2)20(14,5)6/h11-18H,7-10H2,1-6H3.
What are the key properties of bromo-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane?
bromo-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane has a molecular weight of 365.21 g/mol, XLogP of 6.52, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromo-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane is sourced from PubChem (CID 4303687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).