C17H18N6O4S — CID 43037177
3-(4-methoxy-N-[2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetyl]anilino)propanamide (PubChem CID 43037177) has the molecular formula C17H18N6O4S and a molecular weight of 402.44 g/mol. Its IUPAC name is 3-(4-methoxy-N-[2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetyl]anilino)propanamide.
| Compound Name | 3-(4-methoxy-N-[2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetyl]anilino)propanamide |
|---|---|
| PubChem CID | 43037177 |
| Molecular Formula | C17H18N6O4S |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 3-(4-methoxy-N-[2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetyl]anilino)propanamide |
| SMILES | COc1ccc(N(CCC(N)=O)C(=O)Cn2nnn(-c3cccs3)c2=O)cc1 |
| InChI | InChI=1S/C17H18N6O4S/c1-27-13-6-4-12(5-7-13)21(9-8-14(18)24)15(25)11-22-17(26)23(20-19-22)16-3-2-10-28-16/h2-7,10H,8-9,11H2,1H3,(H2,18,24) |
| InChIKey | TWQIGSBWNBASHQ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 125.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |