About 3-(4H-3,1-benzothiazin-2-ylsulfanyl)azepan-2-one
3-(4H-3,1-benzothiazin-2-ylsulfanyl)azepan-2-one (PubChem CID 43038027) has the molecular formula C14H16N2OS2
and a molecular weight of 292.43 g/mol. Its IUPAC name is 3-(4H-3,1-benzothiazin-2-ylsulfanyl)azepan-2-one.
Molecular Properties
| Compound Name | 3-(4H-3,1-benzothiazin-2-ylsulfanyl)azepan-2-one |
| PubChem CID | 43038027 |
| Molecular Formula | C14H16N2OS2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 3-(4H-3,1-benzothiazin-2-ylsulfanyl)azepan-2-one |
| SMILES | O=C1NCCCCC1SC1=Nc2ccccc2CS1 |
| InChI | InChI=1S/C14H16N2OS2/c17-13-12(7-3-4-8-15-13)19-14-16-11-6-2-1-5-10(11)9-18-14/h1-2,5-6,12H,3-4,7-9H2,(H,15,17) |
| InChIKey | CSQRUSVHLZUUKB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4H-3,1-benzothiazin-2-ylsulfanyl)azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4H-3,1-benzothiazin-2-ylsulfanyl)azepan-2-one?
The IUPAC name of 3-(4H-3,1-benzothiazin-2-ylsulfanyl)azepan-2-one (CID 43038027) is 3-(4H-3,1-benzothiazin-2-ylsulfanyl)azepan-2-one.
What is the SMILES notation for 3-(4H-3,1-benzothiazin-2-ylsulfanyl)azepan-2-one?
The canonical SMILES for 3-(4H-3,1-benzothiazin-2-ylsulfanyl)azepan-2-one is O=C1NCCCCC1SC1=Nc2ccccc2CS1.
What is the InChIKey of 3-(4H-3,1-benzothiazin-2-ylsulfanyl)azepan-2-one?
The InChIKey is CSQRUSVHLZUUKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2OS2/c17-13-12(7-3-4-8-15-13)19-14-16-11-6-2-1-5-10(11)9-18-14/h1-2,5-6,12H,3-4,7-9H2,(H,15,17).
What are the key properties of 3-(4H-3,1-benzothiazin-2-ylsulfanyl)azepan-2-one?
3-(4H-3,1-benzothiazin-2-ylsulfanyl)azepan-2-one has a molecular weight of 292.43 g/mol, XLogP of 3.32, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4H-3,1-benzothiazin-2-ylsulfanyl)azepan-2-one is sourced from PubChem (CID 43038027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).