About [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate
[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate (PubChem CID 43038114) has the molecular formula C24H23N3O4
and a molecular weight of 417.47 g/mol. Its IUPAC name is [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate |
| PubChem CID | 43038114 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)COC(=O)C1CCN(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C24H23N3O4/c1-15-22(17-6-2-3-7-18(17)25-15)20(28)14-30-23(29)16-10-12-27(13-11-16)24-26-19-8-4-5-9-21(19)31-24/h2-9,16,25H,10-14H2,1H3 |
| InChIKey | IWFOOWKVIVKRJG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate?
The IUPAC name of [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate (CID 43038114) is [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate.
What is the SMILES notation for [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate?
The canonical SMILES for [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate is Cc1[nH]c2ccccc2c1C(=O)COC(=O)C1CCN(c2nc3ccccc3o2)CC1.
What is the InChIKey of [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate?
The InChIKey is IWFOOWKVIVKRJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23N3O4/c1-15-22(17-6-2-3-7-18(17)25-15)20(28)14-30-23(29)16-10-12-27(13-11-16)24-26-19-8-4-5-9-21(19)31-24/h2-9,16,25H,10-14H2,1H3.
What are the key properties of [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate?
[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate has a molecular weight of 417.47 g/mol, XLogP of 4.26, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 1-(1,3-benzoxazol-2-yl)piperidine-4-carboxylate is sourced from PubChem (CID 43038114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).