C22H20N4O4 — CID 43038235
N'-(2,5-dimethylfuran-3-carbonyl)-3-methyl-6-(4-methylphenyl)-[1,2]oxazolo[5,4-b]pyridine-4-carbohydrazide (PubChem CID 43038235) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is N'-(2,5-dimethylfuran-3-carbonyl)-3-methyl-6-(4-methylphenyl)-[1,2]oxazolo[5,4-b]pyridine-4-carbohydrazide.
| Compound Name | N'-(2,5-dimethylfuran-3-carbonyl)-3-methyl-6-(4-methylphenyl)-[1,2]oxazolo[5,4-b]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 43038235 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N'-(2,5-dimethylfuran-3-carbonyl)-3-methyl-6-(4-methylphenyl)-[1,2]oxazolo[5,4-b]pyridine-4-carbohydrazide |
| SMILES | Cc1ccc(-c2cc(C(=O)NNC(=O)c3cc(C)oc3C)c3c(C)noc3n2)cc1 |
| InChI | InChI=1S/C22H20N4O4/c1-11-5-7-15(8-6-11)18-10-17(19-13(3)26-30-22(19)23-18)21(28)25-24-20(27)16-9-12(2)29-14(16)4/h5-10H,1-4H3,(H,24,27)(H,25,28) |
| InChIKey | UFOFPZOOYJAMAK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|