About 2-(2-chlorophenyl)-4-(2,3-dichloro-4-ethylsulfonylphenyl)-1,3-thiazole
2-(2-chlorophenyl)-4-(2,3-dichloro-4-ethylsulfonylphenyl)-1,3-thiazole (PubChem CID 4303837) has the molecular formula C17H12Cl3NO2S2
and a molecular weight of 432.78 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4-(2,3-dichloro-4-ethylsulfonylphenyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(2-chlorophenyl)-4-(2,3-dichloro-4-ethylsulfonylphenyl)-1,3-thiazole |
| PubChem CID | 4303837 |
| Molecular Formula | C17H12Cl3NO2S2 |
| Molecular Weight | 432.78 g/mol |
| Exact Mass | 430.94 |
| IUPAC Name | 2-(2-chlorophenyl)-4-(2,3-dichloro-4-ethylsulfonylphenyl)-1,3-thiazole |
| SMILES | CCS(=O)(=O)c1ccc(-c2csc(-c3ccccc3Cl)n2)c(Cl)c1Cl |
| InChI | InChI=1S/C17H12Cl3NO2S2/c1-2-25(22,23)14-8-7-11(15(19)16(14)20)13-9-24-17(21-13)10-5-3-4-6-12(10)18/h3-9H,2H2,1H3 |
| InChIKey | SNGPZFLLHKWETL-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.78 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-chlorophenyl)-4-(2,3-dichloro-4-ethylsulfonylphenyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chlorophenyl)-4-(2,3-dichloro-4-ethylsulfonylphenyl)-1,3-thiazole?
The IUPAC name of 2-(2-chlorophenyl)-4-(2,3-dichloro-4-ethylsulfonylphenyl)-1,3-thiazole (CID 4303837) is 2-(2-chlorophenyl)-4-(2,3-dichloro-4-ethylsulfonylphenyl)-1,3-thiazole.
What is the SMILES notation for 2-(2-chlorophenyl)-4-(2,3-dichloro-4-ethylsulfonylphenyl)-1,3-thiazole?
The canonical SMILES for 2-(2-chlorophenyl)-4-(2,3-dichloro-4-ethylsulfonylphenyl)-1,3-thiazole is CCS(=O)(=O)c1ccc(-c2csc(-c3ccccc3Cl)n2)c(Cl)c1Cl.
What is the InChIKey of 2-(2-chlorophenyl)-4-(2,3-dichloro-4-ethylsulfonylphenyl)-1,3-thiazole?
The InChIKey is SNGPZFLLHKWETL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12Cl3NO2S2/c1-2-25(22,23)14-8-7-11(15(19)16(14)20)13-9-24-17(21-13)10-5-3-4-6-12(10)18/h3-9H,2H2,1H3.
What are the key properties of 2-(2-chlorophenyl)-4-(2,3-dichloro-4-ethylsulfonylphenyl)-1,3-thiazole?
2-(2-chlorophenyl)-4-(2,3-dichloro-4-ethylsulfonylphenyl)-1,3-thiazole has a molecular weight of 432.78 g/mol, XLogP of 6.23, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chlorophenyl)-4-(2,3-dichloro-4-ethylsulfonylphenyl)-1,3-thiazole is sourced from PubChem (CID 4303837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).